C16H26N4OS — CID 111529645
1-[(2-ethoxy-3-pyridinyl)methyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine (PubChem CID 111529645) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is 1-[(2-ethoxy-3-pyridinyl)methyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine.
| Compound Name | 1-[(2-ethoxy-3-pyridinyl)methyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine |
|---|---|
| PubChem CID | 111529645 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-[(2-ethoxy-3-pyridinyl)methyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine |
| SMILES | CCOc1ncccc1CN/C(=N\C)NC1CCC(SC)C1 |
| InChI | InChI=1S/C16H26N4OS/c1-4-21-15-12(6-5-9-18-15)11-19-16(17-2)20-13-7-8-14(10-13)22-3/h5-6,9,13-14H,4,7-8,10-11H2,1-3H3,(H2,17,19,20) |
| InChIKey | LNRHTRAMDYWJEX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|