C9H20IN3S — CID 111530252
2-ethyl-1-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 111530252) has the molecular formula C9H20IN3S and a molecular weight of 329.25 g/mol. Its IUPAC name is 2-ethyl-1-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 2-ethyl-1-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111530252 |
| Molecular Formula | C9H20IN3S |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-ethyl-1-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | CC/N=C(\N)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C9H19N3S.HI/c1-3-11-9(10)12-7-4-5-8(6-7)13-2;/h7-8H,3-6H2,1-2H3,(H3,10,11,12);1H |
| InChIKey | DLEOOAQWFNMXSU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|