C20H33NO4Si — CID 11153193
methyl (4R,10aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-2,3,4,8,9,10-hexahydro-1H-cyclopenta[i]indolizine-7-carboxylate (PubChem CID 11153193) has the molecular formula C20H33NO4Si and a molecular weight of 379.57 g/mol. Its IUPAC name is methyl (4R,10aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-2,3,4,8,9,10-hexahydro-1H-cyclopenta[i]indolizine-7-carboxylate.
| Compound Name | methyl (4R,10aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-2,3,4,8,9,10-hexahydro-1H-cyclopenta[i]indolizine-7-carboxylate |
|---|---|
| PubChem CID | 11153193 |
| Molecular Formula | C20H33NO4Si |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | methyl (4R,10aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-2,3,4,8,9,10-hexahydro-1H-cyclopenta[i]indolizine-7-carboxylate |
| SMILES | COC(=O)C1=C2CCC[C@]23CCC[C@H](CO[Si](C)(C)C(C)(C)C)N3C1=O |
| InChI | InChI=1S/C20H33NO4Si/c1-19(2,3)26(5,6)25-13-14-9-7-11-20-12-8-10-15(20)16(18(23)24-4)17(22)21(14)20/h14H,7-13H2,1-6H3/t14-,20-/m1/s1 |
| InChIKey | JBKXRISQVICZHR-JLTOFOAXSA-N |
| XLogP | 3.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|