C22H31N5OS — CID 111532253
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111532253) has the molecular formula C22H31N5OS and a molecular weight of 413.59 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111532253 |
| Molecular Formula | C22H31N5OS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1CN1CCCC1=O)NCCc1ncc(CC)s1 |
| InChI | InChI=1S/C22H31N5OS/c1-3-19-15-25-20(29-19)11-12-24-22(23-4-2)26-14-17-8-5-6-9-18(17)16-27-13-7-10-21(27)28/h5-6,8-9,15H,3-4,7,10-14,16H2,1-2H3,(H2,23,24,26) |
| InChIKey | XRLKRFNMJYZCGY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|