About 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide
4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide (PubChem CID 11153237) has the molecular formula C20H17F2N5O
and a molecular weight of 381.39 g/mol. Its IUPAC name is 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide |
| PubChem CID | 11153237 |
| Molecular Formula | C20H17F2N5O |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide |
| SMILES | N#CC1(c2cc(F)cc(F)c2)CCN(C(=O)Nc2n[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C20H17F2N5O/c21-14-9-13(10-15(22)11-14)20(12-23)5-7-27(8-6-20)19(28)24-18-16-3-1-2-4-17(16)25-26-18/h1-4,9-11H,5-8H2,(H2,24,25,26,28) |
| InChIKey | QUQOFKZXLNWQLX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide?
The IUPAC name of 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide (CID 11153237) is 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide.
What is the SMILES notation for 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide?
The canonical SMILES for 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide is N#CC1(c2cc(F)cc(F)c2)CCN(C(=O)Nc2n[nH]c3ccccc23)CC1.
What is the InChIKey of 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide?
The InChIKey is QUQOFKZXLNWQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F2N5O/c21-14-9-13(10-15(22)11-14)20(12-23)5-7-27(8-6-20)19(28)24-18-16-3-1-2-4-17(16)25-26-18/h1-4,9-11H,5-8H2,(H2,24,25,26,28).
What are the key properties of 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide?
4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide has a molecular weight of 381.39 g/mol, XLogP of 3.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-4-(3,5-difluorophenyl)-N-(1H-indazol-3-yl)piperidine-1-carboxamide is sourced from PubChem (CID 11153237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).