C24H23N5 — CID 11153246
7-(4-methylpiperazin-1-yl)-2,3-diphenylpyrido[2,3-b]pyrazine (PubChem CID 11153246) has the molecular formula C24H23N5 and a molecular weight of 381.48 g/mol. Its IUPAC name is 7-(4-methylpiperazin-1-yl)-2,3-diphenylpyrido[2,3-b]pyrazine.
| Compound Name | 7-(4-methylpiperazin-1-yl)-2,3-diphenylpyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 11153246 |
| Molecular Formula | C24H23N5 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 7-(4-methylpiperazin-1-yl)-2,3-diphenylpyrido[2,3-b]pyrazine |
| SMILES | CN1CCN(c2cnc3nc(-c4ccccc4)c(-c4ccccc4)nc3c2)CC1 |
| InChI | InChI=1S/C24H23N5/c1-28-12-14-29(15-13-28)20-16-21-24(25-17-20)27-23(19-10-6-3-7-11-19)22(26-21)18-8-4-2-5-9-18/h2-11,16-17H,12-15H2,1H3 |
| InChIKey | SARNPBRPQASTSV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |