C21H34IN5S — CID 111533478
2-[2-(dimethylamino)-3-phenylpropyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111533478) has the molecular formula C21H34IN5S and a molecular weight of 515.51 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-3-phenylpropyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(dimethylamino)-3-phenylpropyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111533478 |
| Molecular Formula | C21H34IN5S |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 2-[2-(dimethylamino)-3-phenylpropyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(Cc1ccccc1)N(C)C)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C21H33N5S.HI/c1-5-19-16-24-20(27-19)12-13-23-21(22-6-2)25-15-18(26(3)4)14-17-10-8-7-9-11-17;/h7-11,16,18H,5-6,12-15H2,1-4H3,(H2,22,23,25);1H |
| InChIKey | HSLWSBMXSHCRDB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|