C21H23NO6 — CID 11153352
(1S,3R,4S,5S,6R,7R)-3-methoxy-5-nitro-6,7-bis(phenylmethoxy)-2-oxabicyclo[2.2.1]heptane (PubChem CID 11153352) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is (1S,3R,4S,5S,6R,7R)-3-methoxy-5-nitro-6,7-bis(phenylmethoxy)-2-oxabicyclo[2.2.1]heptane.
| Compound Name | (1S,3R,4S,5S,6R,7R)-3-methoxy-5-nitro-6,7-bis(phenylmethoxy)-2-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 11153352 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (1S,3R,4S,5S,6R,7R)-3-methoxy-5-nitro-6,7-bis(phenylmethoxy)-2-oxabicyclo[2.2.1]heptane |
| SMILES | CO[C@@H]1O[C@H]2[C@H](OCc3ccccc3)[C@@H]1[C@H]([N+](=O)[O-])[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C21H23NO6/c1-25-21-16-17(22(23)24)19(27-13-15-10-6-3-7-11-15)20(28-21)18(16)26-12-14-8-4-2-5-9-14/h2-11,16-21H,12-13H2,1H3/t16-,17-,18+,19+,20-,21+/m0/s1 |
| InChIKey | OOBAOXXDEPOFBD-MKUJHJDCSA-N |
| XLogP | 2.80 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|