About 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone
1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone (PubChem CID 11153426) has the molecular formula C25H26NOP
and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone.
Molecular Properties
| Compound Name | 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone |
| PubChem CID | 11153426 |
| Molecular Formula | C25H26NOP |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone |
| SMILES | O=C(C=P(c1ccccc1)(c1ccccc1)c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C25H26NOP/c27-25(26-19-11-4-12-20-26)21-28(22-13-5-1-6-14-22,23-15-7-2-8-16-23)24-17-9-3-10-18-24/h1-3,5-10,13-18,21H,4,11-12,19-20H2 |
| InChIKey | JBFDMRDAVNVELG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone?
The IUPAC name of 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone (CID 11153426) is 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone.
What is the SMILES notation for 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone?
The canonical SMILES for 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone is O=C(C=P(c1ccccc1)(c1ccccc1)c1ccccc1)N1CCCCC1.
What is the InChIKey of 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone?
The InChIKey is JBFDMRDAVNVELG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26NOP/c27-25(26-19-11-4-12-20-26)21-28(22-13-5-1-6-14-22,23-15-7-2-8-16-23)24-17-9-3-10-18-24/h1-3,5-10,13-18,21H,4,11-12,19-20H2.
What are the key properties of 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone?
1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone has a molecular weight of 387.46 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-1-yl-2-(triphenyl-λ5-phosphanylidene)ethanone is sourced from PubChem (CID 11153426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).