C21H29N3O4 — CID 11153428
(2S,3S,5R)-N,5-dihydroxy-2-[4-(3-propan-2-ylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]piperidine-3-carboxamide (PubChem CID 11153428) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is (2S,3S,5R)-N,5-dihydroxy-2-[4-(3-propan-2-ylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]piperidine-3-carboxamide.
| Compound Name | (2S,3S,5R)-N,5-dihydroxy-2-[4-(3-propan-2-ylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 11153428 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (2S,3S,5R)-N,5-dihydroxy-2-[4-(3-propan-2-ylphenyl)-3,6-dihydro-2H-pyridine-1-carbonyl]piperidine-3-carboxamide |
| SMILES | CC(C)c1cccc(C2=CCN(C(=O)[C@H]3NC[C@H](O)C[C@@H]3C(=O)NO)CC2)c1 |
| InChI | InChI=1S/C21H29N3O4/c1-13(2)15-4-3-5-16(10-15)14-6-8-24(9-7-14)21(27)19-18(20(26)23-28)11-17(25)12-22-19/h3-6,10,13,17-19,22,25,28H,7-9,11-12H2,1-2H3,(H,23,26)/t17-,18+,19+/m1/s1 |
| InChIKey | IBUHVGDAQKRRDT-QYZOEREBSA-N |
| XLogP | 1.27 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|