C19H29IN4S — CID 111534907
1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-(2-methyl-2-phenylpropyl)guanidine;hydroiodide (PubChem CID 111534907) has the molecular formula C19H29IN4S and a molecular weight of 472.44 g/mol. Its IUPAC name is 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-(2-methyl-2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-(2-methyl-2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111534907 |
| Molecular Formula | C19H29IN4S |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-(2-methyl-2-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)NCC(C)(C)c1ccccc1.I |
| InChI | InChI=1S/C19H28N4S.HI/c1-5-16-12-21-17(24-16)13-22-18(20-6-2)23-14-19(3,4)15-10-8-7-9-11-15;/h7-12H,5-6,13-14H2,1-4H3,(H2,20,22,23);1H |
| InChIKey | UUFYZKSQKFZAFZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|