C21H33IN6OS — CID 111535035
N-[2-(dimethylamino)ethyl]-3-[[[ethylamino-[(5-ethyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111535035) has the molecular formula C21H33IN6OS and a molecular weight of 544.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[[[ethylamino-[(5-ethyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[[[ethylamino-[(5-ethyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111535035 |
| Molecular Formula | C21H33IN6OS |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[[[ethylamino-[(5-ethyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NCCN(C)C)c1)NCc1ncc(CC)s1.I |
| InChI | InChI=1S/C21H32N6OS.HI/c1-5-18-14-24-19(29-18)15-26-21(22-6-2)25-13-16-8-7-9-17(12-16)20(28)23-10-11-27(3)4;/h7-9,12,14H,5-6,10-11,13,15H2,1-4H3,(H,23,28)(H2,22,25,26);1H |
| InChIKey | YTJZXOMOPMNDQF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|