C17H25F3N6OS — CID 111535482
1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine (PubChem CID 111535482) has the molecular formula C17H25F3N6OS and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine.
| Compound Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111535482 |
| Molecular Formula | C17H25F3N6OS |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)NCCC(O)(c1nccn1C)C(F)(F)F |
| InChI | InChI=1S/C17H25F3N6OS/c1-4-12-10-24-13(28-12)11-25-15(21-5-2)23-7-6-16(27,17(18,19)20)14-22-8-9-26(14)3/h8-10,27H,4-7,11H2,1-3H3,(H2,21,23,25) |
| InChIKey | CLCZTLAOJSCPPR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|