C22H32O6 — CID 11153571
dimethyl 2-(3-methylbuta-1,2-dienyl)-2-[(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohept-2-en-1-yl]propanedioate (PubChem CID 11153571) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is dimethyl 2-(3-methylbuta-1,2-dienyl)-2-[(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohept-2-en-1-yl]propanedioate.
| Compound Name | dimethyl 2-(3-methylbuta-1,2-dienyl)-2-[(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohept-2-en-1-yl]propanedioate |
|---|---|
| PubChem CID | 11153571 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | dimethyl 2-(3-methylbuta-1,2-dienyl)-2-[(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohept-2-en-1-yl]propanedioate |
| SMILES | COC(=O)C(C=C=C(C)C)(C(=O)OC)[C@H]1C=C[C@H](C(=O)OC(C)(C)C)CCC1 |
| InChI | InChI=1S/C22H32O6/c1-15(2)13-14-22(19(24)26-6,20(25)27-7)17-10-8-9-16(11-12-17)18(23)28-21(3,4)5/h11-12,14,16-17H,8-10H2,1-7H3/t16-,17-/m1/s1 |
| InChIKey | MJDWUEIUZFQWHF-IAGOWNOFSA-N |
| XLogP | 3.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|