C13H14Br2O4 — CID 11153606
(4aS)-6,8-dibromo-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione (PubChem CID 11153606) has the molecular formula C13H14Br2O4 and a molecular weight of 394.06 g/mol. Its IUPAC name is (4aS)-6,8-dibromo-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione.
| Compound Name | (4aS)-6,8-dibromo-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione |
|---|---|
| PubChem CID | 11153606 |
| Molecular Formula | C13H14Br2O4 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | (4aS)-6,8-dibromo-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione |
| SMILES | CC(C)CC[C@]12C=C(Br)C(=O)C(Br)=C1OCC(=O)O2 |
| InChI | InChI=1S/C13H14Br2O4/c1-7(2)3-4-13-5-8(14)11(17)10(15)12(13)18-6-9(16)19-13/h5,7H,3-4,6H2,1-2H3/t13-/m0/s1 |
| InChIKey | MDSWJXYCQYDCQT-ZDUSSCGKSA-N |
| XLogP | 3.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|