C24H33N3O2 — CID 11153651
[(11R)-11-cyclohexyl-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]methanone (PubChem CID 11153651) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is [(11R)-11-cyclohexyl-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]methanone.
| Compound Name | [(11R)-11-cyclohexyl-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 11153651 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | [(11R)-11-cyclohexyl-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2cn3c4c(cccc24)OC[C@H]3C2CCCCC2)C[C@H](C)N1C |
| InChI | InChI=1S/C24H33N3O2/c1-16-12-26(13-17(2)25(16)3)24(28)20-14-27-21(18-8-5-4-6-9-18)15-29-22-11-7-10-19(20)23(22)27/h7,10-11,14,16-18,21H,4-6,8-9,12-13,15H2,1-3H3/t16-,17+,21-/m0/s1 |
| InChIKey | DUUIKOXVOUKEBZ-FVJLSDCUSA-N |
| XLogP | 4.32 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |