C17H18ClN3O2S2 — CID 11153660
5-chloro-N-[2-methyl-1-(2-phenylpyrazol-3-yl)propyl]thiophene-2-sulfonamide (PubChem CID 11153660) has the molecular formula C17H18ClN3O2S2 and a molecular weight of 395.94 g/mol. Its IUPAC name is 5-chloro-N-[2-methyl-1-(2-phenylpyrazol-3-yl)propyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-methyl-1-(2-phenylpyrazol-3-yl)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 11153660 |
| Molecular Formula | C17H18ClN3O2S2 |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 5-chloro-N-[2-methyl-1-(2-phenylpyrazol-3-yl)propyl]thiophene-2-sulfonamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(Cl)s1)c1ccnn1-c1ccccc1 |
| InChI | InChI=1S/C17H18ClN3O2S2/c1-12(2)17(20-25(22,23)16-9-8-15(18)24-16)14-10-11-19-21(14)13-6-4-3-5-7-13/h3-12,17,20H,1-2H3 |
| InChIKey | VUJRTRFALCAJAK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |