C17H20N2O2S — CID 111537981
2-(1-hydroxycyclohexyl)-N-(4-phenyl-1,3-thiazol-5-yl)acetamide (PubChem CID 111537981) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 2-(1-hydroxycyclohexyl)-N-(4-phenyl-1,3-thiazol-5-yl)acetamide.
| Compound Name | 2-(1-hydroxycyclohexyl)-N-(4-phenyl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 111537981 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-(1-hydroxycyclohexyl)-N-(4-phenyl-1,3-thiazol-5-yl)acetamide |
| SMILES | O=C(CC1(O)CCCCC1)Nc1scnc1-c1ccccc1 |
| InChI | InChI=1S/C17H20N2O2S/c20-14(11-17(21)9-5-2-6-10-17)19-16-15(18-12-22-16)13-7-3-1-4-8-13/h1,3-4,7-8,12,21H,2,5-6,9-11H2,(H,19,20) |
| InChIKey | XTOPQTOWKBPLON-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |