C14H22F4N2O2 — CID 111538741
2-(1-hydroxycyclopentyl)-1-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]ethanone (PubChem CID 111538741) has the molecular formula C14H22F4N2O2 and a molecular weight of 326.33 g/mol. Its IUPAC name is 2-(1-hydroxycyclopentyl)-1-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1-hydroxycyclopentyl)-1-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 111538741 |
| Molecular Formula | C14H22F4N2O2 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-(1-hydroxycyclopentyl)-1-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CC1(O)CCCC1)N1CCN(CC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C14H22F4N2O2/c15-12(16)14(17,18)10-19-5-7-20(8-6-19)11(21)9-13(22)3-1-2-4-13/h12,22H,1-10H2 |
| InChIKey | CCHUDUQMMTVMHB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|