About 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea
1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea (PubChem CID 11154001) has the molecular formula C22H26N6O2
and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea.
Molecular Properties
| Compound Name | 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea |
| PubChem CID | 11154001 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1ccc(-c2c(N)nc(N)nc2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N6O2/c1-14(2)25-22(29)26-17-10-8-16(9-11-17)19-18(27-21(24)28-20(19)23)13-30-12-15-6-4-3-5-7-15/h3-11,14H,12-13H2,1-2H3,(H2,25,26,29)(H4,23,24,27,28) |
| InChIKey | WRFODILBPBFVTC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea?
The IUPAC name of 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea (CID 11154001) is 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea.
What is the SMILES notation for 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea?
The canonical SMILES for 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea is CC(C)NC(=O)Nc1ccc(-c2c(N)nc(N)nc2COCc2ccccc2)cc1.
What is the InChIKey of 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea?
The InChIKey is WRFODILBPBFVTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N6O2/c1-14(2)25-22(29)26-17-10-8-16(9-11-17)19-18(27-21(24)28-20(19)23)13-30-12-15-6-4-3-5-7-15/h3-11,14H,12-13H2,1-2H3,(H2,25,26,29)(H4,23,24,27,28).
What are the key properties of 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea?
1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea has a molecular weight of 406.49 g/mol, XLogP of 3.55, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-propan-2-ylurea is sourced from PubChem (CID 11154001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).