About 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone
2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone (PubChem CID 111540324) has the molecular formula C16H21NO3
and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone.
Molecular Properties
| Compound Name | 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone |
| PubChem CID | 111540324 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone |
| SMILES | Cc1ccc2c(c1)OCCN2C(=O)CC1(O)CCCC1 |
| InChI | InChI=1S/C16H21NO3/c1-12-4-5-13-14(10-12)20-9-8-17(13)15(18)11-16(19)6-2-3-7-16/h4-5,10,19H,2-3,6-9,11H2,1H3 |
| InChIKey | WYJAMNYXJDJGPX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone?
The IUPAC name of 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone (CID 111540324) is 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone.
What is the SMILES notation for 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone?
The canonical SMILES for 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone is Cc1ccc2c(c1)OCCN2C(=O)CC1(O)CCCC1.
What is the InChIKey of 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone?
The InChIKey is WYJAMNYXJDJGPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3/c1-12-4-5-13-14(10-12)20-9-8-17(13)15(18)11-16(19)6-2-3-7-16/h4-5,10,19H,2-3,6-9,11H2,1H3.
What are the key properties of 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone?
2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone has a molecular weight of 275.35 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxycyclopentyl)-1-(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone is sourced from PubChem (CID 111540324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).