About 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone
1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone (PubChem CID 111540753) has the molecular formula C17H23FN2O2
and a molecular weight of 306.38 g/mol. Its IUPAC name is 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone.
Molecular Properties
| Compound Name | 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone |
| PubChem CID | 111540753 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone |
| SMILES | CN1CCN(C(=O)CC2(O)CCCCC2)c2ccc(F)cc21 |
| InChI | InChI=1S/C17H23FN2O2/c1-19-9-10-20(14-6-5-13(18)11-15(14)19)16(21)12-17(22)7-3-2-4-8-17/h5-6,11,22H,2-4,7-10,12H2,1H3 |
| InChIKey | JCYOEAZAIBZBKU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone?
The IUPAC name of 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone (CID 111540753) is 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone.
What is the SMILES notation for 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone?
The canonical SMILES for 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone is CN1CCN(C(=O)CC2(O)CCCCC2)c2ccc(F)cc21.
What is the InChIKey of 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone?
The InChIKey is JCYOEAZAIBZBKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23FN2O2/c1-19-9-10-20(14-6-5-13(18)11-15(14)19)16(21)12-17(22)7-3-2-4-8-17/h5-6,11,22H,2-4,7-10,12H2,1H3.
What are the key properties of 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone?
1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone has a molecular weight of 306.38 g/mol, XLogP of 2.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)-2-(1-hydroxycyclohexyl)ethanone is sourced from PubChem (CID 111540753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).