C22H33IN8 — CID 111541787
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide (PubChem CID 111541787) has the molecular formula C22H33IN8 and a molecular weight of 536.47 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111541787 |
| Molecular Formula | C22H33IN8 |
| Molecular Weight | 536.47 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide |
| SMILES | Cc1cc(C)n(CCCN/C(=N\Cc2nnc(C)n2C)NC(C)c2ccccc2)n1.I |
| InChI | InChI=1S/C22H32N8.HI/c1-16-14-17(2)30(28-16)13-9-12-23-22(24-15-21-27-26-19(4)29(21)5)25-18(3)20-10-7-6-8-11-20;/h6-8,10-11,14,18H,9,12-13,15H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | HSPJTZRVAICXLF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|