C20H34O7Si — CID 11154218
[(2R,4S,5E,7S,8S)-7-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-8-yl] acetate (PubChem CID 11154218) has the molecular formula C20H34O7Si and a molecular weight of 414.57 g/mol. Its IUPAC name is [(2R,4S,5E,7S,8S)-7-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-8-yl] acetate.
| Compound Name | [(2R,4S,5E,7S,8S)-7-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-8-yl] acetate |
|---|---|
| PubChem CID | 11154218 |
| Molecular Formula | C20H34O7Si |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | [(2R,4S,5E,7S,8S)-7-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C)OC(=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H34O7Si/c1-13-11-16(27-28(7,8)20(4,5)6)9-10-17(25-14(2)21)18(26-15(3)22)12-19(23)24-13/h9-10,13,16-18H,11-12H2,1-8H3/b10-9+/t13-,16-,17+,18+/m1/s1 |
| InChIKey | WGMDRJOGGHIIMV-ZKXVHXFZSA-N |
| XLogP | 3.52 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|