About N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide
N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide (PubChem CID 11154247) has the molecular formula C28H33NO2
and a molecular weight of 415.58 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide.
Molecular Properties
| Compound Name | N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide |
| PubChem CID | 11154247 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide |
| SMILES | CCCCCC(O)(C(=O)NCCC(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO2/c1-2-3-13-21-28(31,25-18-11-6-12-19-25)27(30)29-22-20-26(23-14-7-4-8-15-23)24-16-9-5-10-17-24/h4-12,14-19,26,31H,2-3,13,20-22H2,1H3,(H,29,30) |
| InChIKey | FZSIKVTUCJXSHD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide?
The IUPAC name of N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide (CID 11154247) is N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide.
What is the SMILES notation for N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide?
The canonical SMILES for N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide is CCCCCC(O)(C(=O)NCCC(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide?
The InChIKey is FZSIKVTUCJXSHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33NO2/c1-2-3-13-21-28(31,25-18-11-6-12-19-25)27(30)29-22-20-26(23-14-7-4-8-15-23)24-16-9-5-10-17-24/h4-12,14-19,26,31H,2-3,13,20-22H2,1H3,(H,29,30).
What are the key properties of N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide?
N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide has a molecular weight of 415.58 g/mol, XLogP of 5.79, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-diphenylpropyl)-2-hydroxy-2-phenylheptanamide is sourced from PubChem (CID 11154247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).