About N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide
N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 111542899) has the molecular formula C15H19N3O3
and a molecular weight of 289.34 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
| PubChem CID | 111542899 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | Cc1ccn2c(=O)c(C(=O)N(C)CC(C)(C)O)cnc2c1 |
| InChI | InChI=1S/C15H19N3O3/c1-10-5-6-18-12(7-10)16-8-11(14(18)20)13(19)17(4)9-15(2,3)21/h5-8,21H,9H2,1-4H3 |
| InChIKey | MJSHSGSSPYAZGB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide?
The IUPAC name of N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide (CID 111542899) is N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide.
What is the SMILES notation for N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide?
The canonical SMILES for N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide is Cc1ccn2c(=O)c(C(=O)N(C)CC(C)(C)O)cnc2c1.
What is the InChIKey of N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide?
The InChIKey is MJSHSGSSPYAZGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3/c1-10-5-6-18-12(7-10)16-8-11(14(18)20)13(19)17(4)9-15(2,3)21/h5-8,21H,9H2,1-4H3.
What are the key properties of N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide?
N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide has a molecular weight of 289.34 g/mol, XLogP of 0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-2-methylpropyl)-N,8-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide is sourced from PubChem (CID 111542899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).