C18H23N3O2 — CID 111544367
1-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-ethyl-2-(furan-2-ylmethyl)guanidine (PubChem CID 111544367) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-ethyl-2-(furan-2-ylmethyl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-ethyl-2-(furan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111544367 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-ethyl-2-(furan-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccco1)NCC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H23N3O2/c1-2-19-18(21-13-15-6-5-10-22-15)20-12-14-9-11-23-17-8-4-3-7-16(14)17/h3-8,10,14H,2,9,11-13H2,1H3,(H2,19,20,21) |
| InChIKey | TTYWEUBZNUPGOR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|