About 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide
6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 11154465) has the molecular formula C17H18ClN5O2S2
and a molecular weight of 423.95 g/mol. Its IUPAC name is 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| PubChem CID | 11154465 |
| Molecular Formula | C17H18ClN5O2S2 |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CN(C)CCn1ccc2cc(NS(=O)(=O)c3c(Cl)nc4sccn34)ccc21 |
| InChI | InChI=1S/C17H18ClN5O2S2/c1-21(2)7-8-22-6-5-12-11-13(3-4-14(12)22)20-27(24,25)16-15(18)19-17-23(16)9-10-26-17/h3-6,9-11,20H,7-8H2,1-2H3 |
| InChIKey | HECZPOPHZKGIII-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The IUPAC name of 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide (CID 11154465) is 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
What is the SMILES notation for 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The canonical SMILES for 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide is CN(C)CCn1ccc2cc(NS(=O)(=O)c3c(Cl)nc4sccn34)ccc21.
What is the InChIKey of 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The InChIKey is HECZPOPHZKGIII-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN5O2S2/c1-21(2)7-8-22-6-5-12-11-13(3-4-14(12)22)20-27(24,25)16-15(18)19-17-23(16)9-10-26-17/h3-6,9-11,20H,7-8H2,1-2H3.
What are the key properties of 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide has a molecular weight of 423.95 g/mol, XLogP of 3.37, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-[1-[2-(dimethylamino)ethyl]indol-5-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide is sourced from PubChem (CID 11154465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).