C20H33N5O3 — CID 111544989
2-[[N-(2-methoxyethyl)-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111544989) has the molecular formula C20H33N5O3 and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-[[N-(2-methoxyethyl)-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-(2-methoxyethyl)-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111544989 |
| Molecular Formula | C20H33N5O3 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 2-[[N-(2-methoxyethyl)-N'-[[2-(morpholin-4-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COCCN/C(=N\Cc1ccccc1CN1CCOCC1)NCC(=O)N(C)C |
| InChI | InChI=1S/C20H33N5O3/c1-24(2)19(26)15-23-20(21-8-11-27-3)22-14-17-6-4-5-7-18(17)16-25-9-12-28-13-10-25/h4-7H,8-16H2,1-3H3,(H2,21,22,23) |
| InChIKey | GJHHMQVSOXZDBN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|