C21H38N4O5 — CID 11154542
N-[4-[(2S,14R)-14-[[formyl(hydroxy)amino]methyl]-3,15-dioxo-1,4-diazacyclopentadec-2-yl]butyl]acetamide (PubChem CID 11154542) has the molecular formula C21H38N4O5 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[4-[(2S,14R)-14-[[formyl(hydroxy)amino]methyl]-3,15-dioxo-1,4-diazacyclopentadec-2-yl]butyl]acetamide.
| Compound Name | N-[4-[(2S,14R)-14-[[formyl(hydroxy)amino]methyl]-3,15-dioxo-1,4-diazacyclopentadec-2-yl]butyl]acetamide |
|---|---|
| PubChem CID | 11154542 |
| Molecular Formula | C21H38N4O5 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | N-[4-[(2S,14R)-14-[[formyl(hydroxy)amino]methyl]-3,15-dioxo-1,4-diazacyclopentadec-2-yl]butyl]acetamide |
| SMILES | CC(=O)NCCCC[C@@H]1NC(=O)[C@@H](CN(O)C=O)CCCCCCCCCNC1=O |
| InChI | InChI=1S/C21H38N4O5/c1-17(27)22-13-10-8-12-19-21(29)23-14-9-6-4-2-3-5-7-11-18(20(28)24-19)15-25(30)16-26/h16,18-19,30H,2-15H2,1H3,(H,22,27)(H,23,29)(H,24,28)/t18-,19+/m1/s1 |
| InChIKey | NKJYIBRDRYQXFN-MOPGFXCFSA-N |
| XLogP | 1.49 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|