C22H30FN7O — CID 11154562
2-N-cyclopent-2-en-1-yl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 11154562) has the molecular formula C22H30FN7O and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-N-cyclopent-2-en-1-yl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-cyclopent-2-en-1-yl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 11154562 |
| Molecular Formula | C22H30FN7O |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-N-cyclopent-2-en-1-yl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN1CCCC1CNc1nc(Nc2ccc(OC)c(F)c2)nc(NC2C=CCC2)n1 |
| InChI | InChI=1S/C22H30FN7O/c1-3-30-12-6-9-17(30)14-24-20-27-21(25-15-7-4-5-8-15)29-22(28-20)26-16-10-11-19(31-2)18(23)13-16/h4,7,10-11,13,15,17H,3,5-6,8-9,12,14H2,1-2H3,(H3,24,25,26,27,28,29) |
| InChIKey | MTMLEUUBBITBFX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|