C19H33N3O4SSi — CID 11154568
2-[tert-butyl(dimethyl)silyl]-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-N,N-dimethylimidazole-1-sulfonamide (PubChem CID 11154568) has the molecular formula C19H33N3O4SSi and a molecular weight of 427.64 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-N,N-dimethylimidazole-1-sulfonamide.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-N,N-dimethylimidazole-1-sulfonamide |
|---|---|
| PubChem CID | 11154568 |
| Molecular Formula | C19H33N3O4SSi |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-N,N-dimethylimidazole-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)n1cc(C2=CCC3(CC2)OCCO3)nc1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H33N3O4SSi/c1-18(2,3)28(6,7)17-20-16(14-22(17)27(23,24)21(4)5)15-8-10-19(11-9-15)25-12-13-26-19/h8,14H,9-13H2,1-7H3 |
| InChIKey | MTBNAVFOGITWSC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|