C26H36O5 — CID 11154592
cis-methyl (1S,2R)-1-[(1E,8E)-deca-1,8-dienyl]-2-[(4-methoxyphenyl)methoxymethyl]-5-oxocyclopentane-1-carboxylate (PubChem CID 11154592) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is cis-methyl (1S,2R)-1-[(1E,8E)-deca-1,8-dienyl]-2-[(4-methoxyphenyl)methoxymethyl]-5-oxocyclopentane-1-carboxylate.
| Compound Name | cis-methyl (1S,2R)-1-[(1E,8E)-deca-1,8-dienyl]-2-[(4-methoxyphenyl)methoxymethyl]-5-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11154592 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | cis-methyl (1S,2R)-1-[(1E,8E)-deca-1,8-dienyl]-2-[(4-methoxyphenyl)methoxymethyl]-5-oxocyclopentane-1-carboxylate |
| SMILES | C/C=C/CCCCC/C=C/[C@@]1(C(=O)OC)C(=O)CC[C@H]1COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H36O5/c1-4-5-6-7-8-9-10-11-18-26(25(28)30-3)22(14-17-24(26)27)20-31-19-21-12-15-23(29-2)16-13-21/h4-5,11-13,15-16,18,22H,6-10,14,17,19-20H2,1-3H3/b5-4+,18-11+/t22-,26-/m0/s1 |
| InChIKey | QJNNQGMXRDHZKR-HOHGMLGGSA-N |
| XLogP | 5.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|