C24H48N2O4 — CID 11154598
(2R,3R)-N,N'-didecyl-2,3-dihydroxybutanediamide (PubChem CID 11154598) has the molecular formula C24H48N2O4 and a molecular weight of 428.66 g/mol. Its IUPAC name is (2R,3R)-N,N'-didecyl-2,3-dihydroxybutanediamide.
| Compound Name | (2R,3R)-N,N'-didecyl-2,3-dihydroxybutanediamide |
|---|---|
| PubChem CID | 11154598 |
| Molecular Formula | C24H48N2O4 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.36 |
| IUPAC Name | (2R,3R)-N,N'-didecyl-2,3-dihydroxybutanediamide |
| SMILES | CCCCCCCCCCNC(=O)[C@H](O)[C@@H](O)C(=O)NCCCCCCCCCC |
| InChI | InChI=1S/C24H48N2O4/c1-3-5-7-9-11-13-15-17-19-25-23(29)21(27)22(28)24(30)26-20-18-16-14-12-10-8-6-4-2/h21-22,27-28H,3-20H2,1-2H3,(H,25,29)(H,26,30)/t21-,22-/m1/s1 |
| InChIKey | AMQIDTPKLJDHGP-FGZHOGPDSA-N |
| XLogP | 4.22 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|