About 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide
3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 11154711) has the molecular formula C20H20N2O5S2
and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 11154711 |
| Molecular Formula | C20H20N2O5S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CC(C)Oc1cc(Oc2ccc(S(C)(=O)=O)cc2)cc(C(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C20H20N2O5S2/c1-13(2)26-16-10-14(19(23)22-20-21-8-9-28-20)11-17(12-16)27-15-4-6-18(7-5-15)29(3,24)25/h4-13H,1-3H3,(H,21,22,23) |
| InChIKey | IBDWQXAELRUGCY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide (CID 11154711) is 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide is CC(C)Oc1cc(Oc2ccc(S(C)(=O)=O)cc2)cc(C(=O)Nc2nccs2)c1.
What is the InChIKey of 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide?
The InChIKey is IBDWQXAELRUGCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O5S2/c1-13(2)26-16-10-14(19(23)22-20-21-8-9-28-20)11-17(12-16)27-15-4-6-18(7-5-15)29(3,24)25/h4-13H,1-3H3,(H,21,22,23).
What are the key properties of 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide?
3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide has a molecular weight of 432.52 g/mol, XLogP of 4.38, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylsulfonylphenoxy)-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 11154711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).