C26H40O5 — CID 11154725
ethyl (E)-3-[(3aR,5R,6R,8aR,9R,9aS)-5-hydroxy-2,2,6,8a-tetramethyl-9-propan-2-yl-5-prop-1-en-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxol-6-yl]prop-2-enoate (PubChem CID 11154725) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is ethyl (E)-3-[(3aR,5R,6R,8aR,9R,9aS)-5-hydroxy-2,2,6,8a-tetramethyl-9-propan-2-yl-5-prop-1-en-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxol-6-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3aR,5R,6R,8aR,9R,9aS)-5-hydroxy-2,2,6,8a-tetramethyl-9-propan-2-yl-5-prop-1-en-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxol-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11154725 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | ethyl (E)-3-[(3aR,5R,6R,8aR,9R,9aS)-5-hydroxy-2,2,6,8a-tetramethyl-9-propan-2-yl-5-prop-1-en-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxol-6-yl]prop-2-enoate |
| SMILES | C=C(C)[C@]1(O)C=C2[C@H]3OC(C)(C)O[C@H]3[C@H](C(C)C)[C@@]2(C)CC[C@]1(C)/C=C/C(=O)OCC |
| InChI | InChI=1S/C26H40O5/c1-10-29-19(27)11-12-24(8)13-14-25(9)18(15-26(24,28)17(4)5)21-22(20(25)16(2)3)31-23(6,7)30-21/h11-12,15-16,20-22,28H,4,10,13-14H2,1-3,5-9H3/b12-11+/t20-,21+,22-,24-,25-,26+/m0/s1 |
| InChIKey | BNMCSDAUBOLHNN-WXXALIRASA-N |
| XLogP | 4.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|