About 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile
4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile (PubChem CID 11154823) has the molecular formula C26H24N6O
and a molecular weight of 436.52 g/mol. Its IUPAC name is 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile |
| PubChem CID | 11154823 |
| Molecular Formula | C26H24N6O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNc2ccc(-c3c(N)nc(N)nc3COCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H24N6O/c27-14-18-6-8-19(9-7-18)15-30-22-12-10-21(11-13-22)24-23(31-26(29)32-25(24)28)17-33-16-20-4-2-1-3-5-20/h1-13,30H,15-17H2,(H4,28,29,31,32) |
| InChIKey | GVRGGYIFRFDABU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile?
The IUPAC name of 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile (CID 11154823) is 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile.
What is the SMILES notation for 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile?
The canonical SMILES for 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile is N#Cc1ccc(CNc2ccc(-c3c(N)nc(N)nc3COCc3ccccc3)cc2)cc1.
What is the InChIKey of 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile?
The InChIKey is GVRGGYIFRFDABU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N6O/c27-14-18-6-8-19(9-7-18)15-30-22-12-10-21(11-13-22)24-23(31-26(29)32-25(24)28)17-33-16-20-4-2-1-3-5-20/h1-13,30H,15-17H2,(H4,28,29,31,32).
What are the key properties of 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile?
4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile has a molecular weight of 436.52 g/mol, XLogP of 4.51, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]anilino]methyl]benzonitrile is sourced from PubChem (CID 11154823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).