About 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea
1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea (PubChem CID 11154832) has the molecular formula C18H15BrF2N4O2
and a molecular weight of 437.24 g/mol. Its IUPAC name is 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea |
| PubChem CID | 11154832 |
| Molecular Formula | C18H15BrF2N4O2 |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2cc(F)cc(F)c2)cc1-c1c(Br)cnn1C |
| InChI | InChI=1S/C18H15BrF2N4O2/c1-25-17(15(19)9-22-25)14-8-12(3-4-16(14)27-2)23-18(26)24-13-6-10(20)5-11(21)7-13/h3-9H,1-2H3,(H2,23,24,26) |
| InChIKey | YMVIRCYNRMVMJQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea?
The IUPAC name of 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea (CID 11154832) is 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea.
What is the SMILES notation for 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea?
The canonical SMILES for 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea is COc1ccc(NC(=O)Nc2cc(F)cc(F)c2)cc1-c1c(Br)cnn1C.
What is the InChIKey of 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea?
The InChIKey is YMVIRCYNRMVMJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrF2N4O2/c1-25-17(15(19)9-22-25)14-8-12(3-4-16(14)27-2)23-18(26)24-13-6-10(20)5-11(21)7-13/h3-9H,1-2H3,(H2,23,24,26).
What are the key properties of 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea?
1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea has a molecular weight of 437.24 g/mol, XLogP of 4.78, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(3,5-difluorophenyl)urea is sourced from PubChem (CID 11154832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).