C17H21BrIN3O — CID 111548560
2-[(4-bromophenyl)methyl]-1-[2-(furan-2-yl)ethyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 111548560) has the molecular formula C17H21BrIN3O and a molecular weight of 490.18 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-1-[2-(furan-2-yl)ethyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[(4-bromophenyl)methyl]-1-[2-(furan-2-yl)ethyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111548560 |
| Molecular Formula | C17H21BrIN3O |
| Molecular Weight | 490.18 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-1-[2-(furan-2-yl)ethyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccc(Br)cc1)NCCc1ccco1.I |
| InChI | InChI=1S/C17H20BrN3O.HI/c1-2-10-19-17(20-11-9-16-4-3-12-22-16)21-13-14-5-7-15(18)8-6-14;/h2-8,12H,1,9-11,13H2,(H2,19,20,21);1H |
| InChIKey | SLOOJGYKNYXJAE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.18 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|