C25H32O5Si — CID 11154913
(2R,3aR,4S,5S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-carbaldehyde (PubChem CID 11154913) has the molecular formula C25H32O5Si and a molecular weight of 440.61 g/mol. Its IUPAC name is (2R,3aR,4S,5S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-carbaldehyde.
| Compound Name | (2R,3aR,4S,5S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-carbaldehyde |
|---|---|
| PubChem CID | 11154913 |
| Molecular Formula | C25H32O5Si |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (2R,3aR,4S,5S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-carbaldehyde |
| SMILES | CO[C@H]1C[C@H]2[C@@H](O1)O[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]2C=O |
| InChI | InChI=1S/C25H32O5Si/c1-25(2,3)31(18-11-7-5-8-12-18,19-13-9-6-10-14-19)28-17-22-21(16-26)20-15-23(27-4)30-24(20)29-22/h5-14,16,20-24H,15,17H2,1-4H3/t20-,21+,22-,23-,24-/m1/s1 |
| InChIKey | RELUMLJTOTXIOL-KEJFTWOCSA-N |
| XLogP | 3.11 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|