C27H25F2N3O — CID 11155028
6-[(6,13-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenylidene)methyl]-3-[2-(dimethylamino)ethyl]-1H-benzimidazol-2-one (PubChem CID 11155028) has the molecular formula C27H25F2N3O and a molecular weight of 445.51 g/mol. Its IUPAC name is 6-[(6,13-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenylidene)methyl]-3-[2-(dimethylamino)ethyl]-1H-benzimidazol-2-one.
| Compound Name | 6-[(6,13-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenylidene)methyl]-3-[2-(dimethylamino)ethyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 11155028 |
| Molecular Formula | C27H25F2N3O |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 6-[(6,13-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenylidene)methyl]-3-[2-(dimethylamino)ethyl]-1H-benzimidazol-2-one |
| SMILES | CN(C)CCn1c(=O)[nH]c2cc(C=C3c4ccc(F)cc4CCc4cc(F)ccc43)ccc21 |
| InChI | InChI=1S/C27H25F2N3O/c1-31(2)11-12-32-26-10-3-17(14-25(26)30-27(32)33)13-24-22-8-6-20(28)15-18(22)4-5-19-16-21(29)7-9-23(19)24/h3,6-10,13-16H,4-5,11-12H2,1-2H3,(H,30,33) |
| InChIKey | LOXKUBVUGZHABF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|