C17H26BrIN4O2 — CID 111550533
3-bromo-N-[3-[[ethylamino-[(3R)-3-hydroxypyrrolidin-1-yl]methylidene]amino]propyl]benzamide;hydroiodide (PubChem CID 111550533) has the molecular formula C17H26BrIN4O2 and a molecular weight of 525.23 g/mol. Its IUPAC name is 3-bromo-N-[3-[[ethylamino-[(3R)-3-hydroxypyrrolidin-1-yl]methylidene]amino]propyl]benzamide;hydroiodide.
| Compound Name | 3-bromo-N-[3-[[ethylamino-[(3R)-3-hydroxypyrrolidin-1-yl]methylidene]amino]propyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111550533 |
| Molecular Formula | C17H26BrIN4O2 |
| Molecular Weight | 525.23 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | 3-bromo-N-[3-[[ethylamino-[(3R)-3-hydroxypyrrolidin-1-yl]methylidene]amino]propyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\CCCNC(=O)c1cccc(Br)c1)N1CC[C@@H](O)C1.I |
| InChI | InChI=1S/C17H25BrN4O2.HI/c1-2-19-17(22-10-7-15(23)12-22)21-9-4-8-20-16(24)13-5-3-6-14(18)11-13;/h3,5-6,11,15,23H,2,4,7-10,12H2,1H3,(H,19,21)(H,20,24);1H/t15-;/m1./s1 |
| InChIKey | HGAGKAZWWFWYRG-XFULWGLBSA-N |
| XLogP | 2.22 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|