C26H26O7 — CID 11155150
(10S,14R)-10,14-bis(4-hydroxyphenyl)-7,16-dioxadispiro[5.2.59.26]hexadecane-8,12,15-trione (PubChem CID 11155150) has the molecular formula C26H26O7 and a molecular weight of 450.49 g/mol. Its IUPAC name is (10S,14R)-10,14-bis(4-hydroxyphenyl)-7,16-dioxadispiro[5.2.59.26]hexadecane-8,12,15-trione.
| Compound Name | (10S,14R)-10,14-bis(4-hydroxyphenyl)-7,16-dioxadispiro[5.2.59.26]hexadecane-8,12,15-trione |
|---|---|
| PubChem CID | 11155150 |
| Molecular Formula | C26H26O7 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (10S,14R)-10,14-bis(4-hydroxyphenyl)-7,16-dioxadispiro[5.2.59.26]hexadecane-8,12,15-trione |
| SMILES | O=C1C[C@H](c2ccc(O)cc2)C2(C(=O)OC3(CCCCC3)OC2=O)[C@H](c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C26H26O7/c27-18-8-4-16(5-9-18)21-14-20(29)15-22(17-6-10-19(28)11-7-17)26(21)23(30)32-25(33-24(26)31)12-2-1-3-13-25/h4-11,21-22,27-28H,1-3,12-15H2/t21-,22+ |
| InChIKey | UTBUUQDRAGENEP-SZPZYZBQSA-N |
| XLogP | 4.07 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|