C29H22OS2 — CID 11155168
(R)-(13-methyl-12,14-dithiapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-phenylmethanol (PubChem CID 11155168) has the molecular formula C29H22OS2 and a molecular weight of 450.63 g/mol. Its IUPAC name is (R)-(13-methyl-12,14-dithiapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-phenylmethanol.
| Compound Name | (R)-(13-methyl-12,14-dithiapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-phenylmethanol |
|---|---|
| PubChem CID | 11155168 |
| Molecular Formula | C29H22OS2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | (R)-(13-methyl-12,14-dithiapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-phenylmethanol |
| SMILES | CC1([C@H](O)c2ccccc2)Sc2ccc3ccccc3c2-c2c(ccc3ccccc23)S1 |
| InChI | InChI=1S/C29H22OS2/c1-29(28(30)21-11-3-2-4-12-21)31-24-17-15-19-9-5-7-13-22(19)26(24)27-23-14-8-6-10-20(23)16-18-25(27)32-29/h2-18,28,30H,1H3/t28-/m1/s1 |
| InChIKey | QXAIGQOKCZXRKH-MUUNZHRXSA-N |
| XLogP | 8.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |