C25H26IN5O3 — CID 111551871
1-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111551871) has the molecular formula C25H26IN5O3 and a molecular weight of 571.42 g/mol. Its IUPAC name is 1-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111551871 |
| Molecular Formula | C25H26IN5O3 |
| Molecular Weight | 571.42 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | 1-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(Oc2cccc(OC)c2)nc1)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C25H25N5O3.HI/c1-26-25(29-16-20-17-32-24(30-20)19-7-4-3-5-8-19)28-15-18-11-12-23(27-14-18)33-22-10-6-9-21(13-22)31-2;/h3-14,17H,15-16H2,1-2H3,(H2,26,28,29);1H |
| InChIKey | VRSCPWVBBJMNGP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|