C16H23N5O3S — CID 111552480
1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine (PubChem CID 111552480) has the molecular formula C16H23N5O3S and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine.
| Compound Name | 1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111552480 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)NCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H23N5O3S/c1-3-25(22,23)20-10-9-18-16(17-2)19-11-14-12-24-15(21-14)13-7-5-4-6-8-13/h4-8,12,20H,3,9-11H2,1-2H3,(H2,17,18,19) |
| InChIKey | JIOFARVRTJJXJT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|