About 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid
3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid (PubChem CID 11155280) has the molecular formula C24H21N7O3
and a molecular weight of 455.48 g/mol. Its IUPAC name is 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid.
Molecular Properties
| Compound Name | 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid |
| PubChem CID | 11155280 |
| Molecular Formula | C24H21N7O3 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid |
| SMILES | Nc1nc(N)c2nc(CN3c4ccccc4C=Cc4cc(OCCC(=O)O)ccc43)cnc2n1 |
| InChI | InChI=1S/C24H21N7O3/c25-22-21-23(30-24(26)29-22)27-12-16(28-21)13-31-18-4-2-1-3-14(18)5-6-15-11-17(7-8-19(15)31)34-10-9-20(32)33/h1-8,11-12H,9-10,13H2,(H,32,33)(H4,25,26,27,29,30) |
| InChIKey | UYSWAPIEBMHQDF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid?
The IUPAC name of 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid (CID 11155280) is 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid.
What is the SMILES notation for 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid?
The canonical SMILES for 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid is Nc1nc(N)c2nc(CN3c4ccccc4C=Cc4cc(OCCC(=O)O)ccc43)cnc2n1.
What is the InChIKey of 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid?
The InChIKey is UYSWAPIEBMHQDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N7O3/c25-22-21-23(30-24(26)29-22)27-12-16(28-21)13-31-18-4-2-1-3-14(18)5-6-15-11-17(7-8-19(15)31)34-10-9-20(32)33/h1-8,11-12H,9-10,13H2,(H,32,33)(H4,25,26,27,29,30).
What are the key properties of 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid?
3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid has a molecular weight of 455.48 g/mol, XLogP of 3.26, 6 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypropanoic acid is sourced from PubChem (CID 11155280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).