C16H21Cl2N3O2S2 — CID 1115531
3-(3,4-dichlorophenyl)-1-[(4S)-5,5-dimethyl-3-(2-methylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea (PubChem CID 1115531) has the molecular formula C16H21Cl2N3O2S2 and a molecular weight of 422.40 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[(4S)-5,5-dimethyl-3-(2-methylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[(4S)-5,5-dimethyl-3-(2-methylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 1115531 |
| Molecular Formula | C16H21Cl2N3O2S2 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[(4S)-5,5-dimethyl-3-(2-methylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea |
| SMILES | CC(C)CN1C(=S)SC(C)(C)[C@@H]1N(O)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2N3O2S2/c1-9(2)8-20-13(16(3,4)25-15(20)24)21(23)14(22)19-10-5-6-11(17)12(18)7-10/h5-7,9,13,23H,8H2,1-4H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | ZSXOXIODKXEIMJ-ZDUSSCGKSA-N |
| XLogP | 5.31 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|