C22H22ClFN6O — CID 111554723
1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 111554723) has the molecular formula C22H22ClFN6O and a molecular weight of 440.91 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111554723 |
| Molecular Formula | C22H22ClFN6O |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1nc(-c2ccc(Cl)cc2)no1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C22H22ClFN6O/c1-25-22(26-10-8-15-13-28-19-12-17(24)6-7-18(15)19)27-11-9-20-29-21(30-31-20)14-2-4-16(23)5-3-14/h2-7,12-13,28H,8-11H2,1H3,(H2,25,26,27) |
| InChIKey | IFNLWRYZNFLHTB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|