C25H25NO6S — CID 11155568
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-thiophen-3-ylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol (PubChem CID 11155568) has the molecular formula C25H25NO6S and a molecular weight of 467.54 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-thiophen-3-ylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-thiophen-3-ylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11155568 |
| Molecular Formula | C25H25NO6S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-thiophen-3-ylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2cccc3[nH]cc(Cc4ccc(-c5ccsc5)cc4)c23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H25NO6S/c27-12-20-22(28)23(29)24(30)25(32-20)31-19-3-1-2-18-21(19)17(11-26-18)10-14-4-6-15(7-5-14)16-8-9-33-13-16/h1-9,11,13,20,22-30H,10,12H2/t20-,22-,23+,24-,25-/m1/s1 |
| InChIKey | QJEODDZMVLCHPR-PRDVQWLOSA-N |
| XLogP | 2.67 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |